C12H18N6S2 — CID 82425346
4-ethyl-3-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 82425346) has the molecular formula C12H18N6S2 and a molecular weight of 310.45 g/mol. Its IUPAC name is 4-ethyl-3-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82425346 |
| Molecular Formula | C12H18N6S2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-ethyl-3-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(-c2cnc(N3CCN(C)CC3)s2)n[nH]c1=S |
| InChI | InChI=1S/C12H18N6S2/c1-3-18-10(14-15-11(18)19)9-8-13-12(20-9)17-6-4-16(2)5-7-17/h8H,3-7H2,1-2H3,(H,15,19) |
| InChIKey | BOCQCPUEKXCMLI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|