C9H12N4S2 — CID 82428073
4-ethyl-3-(4-ethyl-1,3-thiazol-5-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 82428073) has the molecular formula C9H12N4S2 and a molecular weight of 240.36 g/mol. Its IUPAC name is 4-ethyl-3-(4-ethyl-1,3-thiazol-5-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-(4-ethyl-1,3-thiazol-5-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82428073 |
| Molecular Formula | C9H12N4S2 |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-ethyl-3-(4-ethyl-1,3-thiazol-5-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1ncsc1-c1n[nH]c(=S)n1CC |
| InChI | InChI=1S/C9H12N4S2/c1-3-6-7(15-5-10-6)8-11-12-9(14)13(8)4-2/h5H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | SYAYLDYYHNFJID-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|