C14H22N4S2 — CID 82432313
4-ethyl-3-[2-(2-methylpropyl)-4-propyl-1,3-thiazol-5-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 82432313) has the molecular formula C14H22N4S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 4-ethyl-3-[2-(2-methylpropyl)-4-propyl-1,3-thiazol-5-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-[2-(2-methylpropyl)-4-propyl-1,3-thiazol-5-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82432313 |
| Molecular Formula | C14H22N4S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 4-ethyl-3-[2-(2-methylpropyl)-4-propyl-1,3-thiazol-5-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1nc(CC(C)C)sc1-c1n[nH]c(=S)n1CC |
| InChI | InChI=1S/C14H22N4S2/c1-5-7-10-12(20-11(15-10)8-9(3)4)13-16-17-14(19)18(13)6-2/h9H,5-8H2,1-4H3,(H,17,19) |
| InChIKey | IPPLTVYEEKRINM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|