C14H16N2O2S2 — CID 82426928
2-[2-(2-methoxyphenoxy)ethyl]-4-methyl-1,3-thiazole-5-carbothioamide (PubChem CID 82426928) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenoxy)ethyl]-4-methyl-1,3-thiazole-5-carbothioamide.
| Compound Name | 2-[2-(2-methoxyphenoxy)ethyl]-4-methyl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82426928 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-[2-(2-methoxyphenoxy)ethyl]-4-methyl-1,3-thiazole-5-carbothioamide |
| SMILES | COc1ccccc1OCCc1nc(C)c(C(N)=S)s1 |
| InChI | InChI=1S/C14H16N2O2S2/c1-9-13(14(15)19)20-12(16-9)7-8-18-11-6-4-3-5-10(11)17-2/h3-6H,7-8H2,1-2H3,(H2,15,19) |
| InChIKey | XGKZPYJCHOSBRN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|