C13H24N2S2 — CID 82429324
N-[[4-ethyl-2-(propylsulfanylmethyl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 82429324) has the molecular formula C13H24N2S2 and a molecular weight of 272.48 g/mol. Its IUPAC name is N-[[4-ethyl-2-(propylsulfanylmethyl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-ethyl-2-(propylsulfanylmethyl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82429324 |
| Molecular Formula | C13H24N2S2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | N-[[4-ethyl-2-(propylsulfanylmethyl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(CSCCC)nc1CC |
| InChI | InChI=1S/C13H24N2S2/c1-4-7-14-9-12-11(6-3)15-13(17-12)10-16-8-5-2/h14H,4-10H2,1-3H3 |
| InChIKey | IJPLKVQFYXWPHV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|