C16H20Cl2N2S — CID 104841447
N-[[2-[(2,4-dichlorophenyl)methyl]-4-ethyl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 104841447) has the molecular formula C16H20Cl2N2S and a molecular weight of 343.32 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methyl]-4-ethyl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methyl]-4-ethyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 104841447 |
| Molecular Formula | C16H20Cl2N2S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methyl]-4-ethyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(Cc2ccc(Cl)cc2Cl)nc1CC |
| InChI | InChI=1S/C16H20Cl2N2S/c1-3-7-19-10-15-14(4-2)20-16(21-15)8-11-5-6-12(17)9-13(11)18/h5-6,9,19H,3-4,7-8,10H2,1-2H3 |
| InChIKey | CRNBDXRJZLIIGA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|