C8H12BrNOS — CID 82430363
5-(bromomethyl)-4-ethyl-2-(methoxymethyl)-1,3-thiazole (PubChem CID 82430363) has the molecular formula C8H12BrNOS and a molecular weight of 250.16 g/mol. Its IUPAC name is 5-(bromomethyl)-4-ethyl-2-(methoxymethyl)-1,3-thiazole.
| Compound Name | 5-(bromomethyl)-4-ethyl-2-(methoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 82430363 |
| Molecular Formula | C8H12BrNOS |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 5-(bromomethyl)-4-ethyl-2-(methoxymethyl)-1,3-thiazole |
| SMILES | CCc1nc(COC)sc1CBr |
| InChI | InChI=1S/C8H12BrNOS/c1-3-6-7(4-9)12-8(10-6)5-11-2/h3-5H2,1-2H3 |
| InChIKey | LEQLRQSYFJKJDA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|