C11H19BrN2S — CID 82430445
N-[[5-(bromomethyl)-4-ethyl-1,3-thiazol-2-yl]methyl]-N-ethylethanamine (PubChem CID 82430445) has the molecular formula C11H19BrN2S and a molecular weight of 291.26 g/mol. Its IUPAC name is N-[[5-(bromomethyl)-4-ethyl-1,3-thiazol-2-yl]methyl]-N-ethylethanamine.
| Compound Name | N-[[5-(bromomethyl)-4-ethyl-1,3-thiazol-2-yl]methyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 82430445 |
| Molecular Formula | C11H19BrN2S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-[[5-(bromomethyl)-4-ethyl-1,3-thiazol-2-yl]methyl]-N-ethylethanamine |
| SMILES | CCc1nc(CN(CC)CC)sc1CBr |
| InChI | InChI=1S/C11H19BrN2S/c1-4-9-10(7-12)15-11(13-9)8-14(5-2)6-3/h4-8H2,1-3H3 |
| InChIKey | MTXCRNKDBFANOE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|