About 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol
2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol (PubChem CID 82431478) has the molecular formula C16H21NOS
and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol.
Molecular Properties
| Compound Name | 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol |
| PubChem CID | 82431478 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol |
| SMILES | CCCc1nc(Cc2ccccc2)sc1C(C)(C)O |
| InChI | InChI=1S/C16H21NOS/c1-4-8-13-15(16(2,3)18)19-14(17-13)11-12-9-6-5-7-10-12/h5-7,9-10,18H,4,8,11H2,1-3H3 |
| InChIKey | MAUPAPGNCDIURL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol?
The IUPAC name of 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol (CID 82431478) is 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol.
What is the SMILES notation for 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol?
The canonical SMILES for 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol is CCCc1nc(Cc2ccccc2)sc1C(C)(C)O.
What is the InChIKey of 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol?
The InChIKey is MAUPAPGNCDIURL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NOS/c1-4-8-13-15(16(2,3)18)19-14(17-13)11-12-9-6-5-7-10-12/h5-7,9-10,18H,4,8,11H2,1-3H3.
What are the key properties of 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol?
2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol has a molecular weight of 275.42 g/mol, XLogP of 3.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzyl-4-propyl-1,3-thiazol-5-yl)propan-2-ol is sourced from PubChem (CID 82431478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).