C11H20N2S2 — CID 82434459
[4-propan-2-yl-2-(propylsulfanylmethyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 82434459) has the molecular formula C11H20N2S2 and a molecular weight of 244.43 g/mol. Its IUPAC name is [4-propan-2-yl-2-(propylsulfanylmethyl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [4-propan-2-yl-2-(propylsulfanylmethyl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82434459 |
| Molecular Formula | C11H20N2S2 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [4-propan-2-yl-2-(propylsulfanylmethyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | CCCSCc1nc(C(C)C)c(CN)s1 |
| InChI | InChI=1S/C11H20N2S2/c1-4-5-14-7-10-13-11(8(2)3)9(6-12)15-10/h8H,4-7,12H2,1-3H3 |
| InChIKey | LWCQYBCIGSJIFB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|