C11H17NOS2 — CID 82434676
[2-(oxolan-2-yl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol (PubChem CID 82434676) has the molecular formula C11H17NOS2 and a molecular weight of 243.40 g/mol. Its IUPAC name is [2-(oxolan-2-yl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [2-(oxolan-2-yl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82434676 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | [2-(oxolan-2-yl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol |
| SMILES | CC(C)c1nc(C2CCCO2)sc1CS |
| InChI | InChI=1S/C11H17NOS2/c1-7(2)10-9(6-14)15-11(12-10)8-4-3-5-13-8/h7-8,14H,3-6H2,1-2H3 |
| InChIKey | BDJWURYEFFPIQA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|