C12H20N2OS2 — CID 82435326
[2-(morpholin-4-ylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol (PubChem CID 82435326) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is [2-(morpholin-4-ylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [2-(morpholin-4-ylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82435326 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | [2-(morpholin-4-ylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol |
| SMILES | CC(C)c1nc(CN2CCOCC2)sc1CS |
| InChI | InChI=1S/C12H20N2OS2/c1-9(2)12-10(8-16)17-11(13-12)7-14-3-5-15-6-4-14/h9,16H,3-8H2,1-2H3 |
| InChIKey | XRXVUQQNXKHPCQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 25.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|