C15H17NOS2 — CID 82437280
[4-cyclopropyl-2-(3-ethoxyphenyl)-1,3-thiazol-5-yl]methanethiol (PubChem CID 82437280) has the molecular formula C15H17NOS2 and a molecular weight of 291.44 g/mol. Its IUPAC name is [4-cyclopropyl-2-(3-ethoxyphenyl)-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [4-cyclopropyl-2-(3-ethoxyphenyl)-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82437280 |
| Molecular Formula | C15H17NOS2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | [4-cyclopropyl-2-(3-ethoxyphenyl)-1,3-thiazol-5-yl]methanethiol |
| SMILES | CCOc1cccc(-c2nc(C3CC3)c(CS)s2)c1 |
| InChI | InChI=1S/C15H17NOS2/c1-2-17-12-5-3-4-11(8-12)15-16-14(10-6-7-10)13(9-18)19-15/h3-5,8,10,18H,2,6-7,9H2,1H3 |
| InChIKey | VAIQDJYRXFAIPM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|