C10H16N2OS3 — CID 82440690
4-(methoxymethyl)-2-(propan-2-ylsulfanylmethyl)-1,3-thiazole-5-carbothioamide (PubChem CID 82440690) has the molecular formula C10H16N2OS3 and a molecular weight of 276.45 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-(propan-2-ylsulfanylmethyl)-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-(methoxymethyl)-2-(propan-2-ylsulfanylmethyl)-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82440690 |
| Molecular Formula | C10H16N2OS3 |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 4-(methoxymethyl)-2-(propan-2-ylsulfanylmethyl)-1,3-thiazole-5-carbothioamide |
| SMILES | COCc1nc(CSC(C)C)sc1C(N)=S |
| InChI | InChI=1S/C10H16N2OS3/c1-6(2)15-5-8-12-7(4-13-3)9(16-8)10(11)14/h6H,4-5H2,1-3H3,(H2,11,14) |
| InChIKey | AAVGAOHAXKCDCM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|