C9H16N2O2S — CID 82441413
1-[2,4-bis(methoxymethyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 82441413) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 1-[2,4-bis(methoxymethyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 1-[2,4-bis(methoxymethyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82441413 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-[2,4-bis(methoxymethyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | COCc1nc(COC)c(C(C)N)s1 |
| InChI | InChI=1S/C9H16N2O2S/c1-6(10)9-7(4-12-2)11-8(14-9)5-13-3/h6H,4-5,10H2,1-3H3 |
| InChIKey | ZJCCSHOODDZVNV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |