C12H21N3OS2 — CID 82441933
[2-(4-ethylpiperazin-1-yl)-4-(methoxymethyl)-1,3-thiazol-5-yl]methanethiol (PubChem CID 82441933) has the molecular formula C12H21N3OS2 and a molecular weight of 287.45 g/mol. Its IUPAC name is [2-(4-ethylpiperazin-1-yl)-4-(methoxymethyl)-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [2-(4-ethylpiperazin-1-yl)-4-(methoxymethyl)-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82441933 |
| Molecular Formula | C12H21N3OS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [2-(4-ethylpiperazin-1-yl)-4-(methoxymethyl)-1,3-thiazol-5-yl]methanethiol |
| SMILES | CCN1CCN(c2nc(COC)c(CS)s2)CC1 |
| InChI | InChI=1S/C12H21N3OS2/c1-3-14-4-6-15(7-5-14)12-13-10(8-16-2)11(9-17)18-12/h17H,3-9H2,1-2H3 |
| InChIKey | FLGGNOXYTJZXHO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 28.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|