C10H13ClN2O2 — CID 82442315
3-(6-oxo-1-propylpyridazin-3-yl)propanoyl chloride (PubChem CID 82442315) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-(6-oxo-1-propylpyridazin-3-yl)propanoyl chloride.
| Compound Name | 3-(6-oxo-1-propylpyridazin-3-yl)propanoyl chloride |
|---|---|
| PubChem CID | 82442315 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-(6-oxo-1-propylpyridazin-3-yl)propanoyl chloride |
| SMILES | CCCn1nc(CCC(=O)Cl)ccc1=O |
| InChI | InChI=1S/C10H13ClN2O2/c1-2-7-13-10(15)6-4-8(12-13)3-5-9(11)14/h4,6H,2-3,5,7H2,1H3 |
| InChIKey | OGOCTPICMDUNMC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|