C17H20N2O2 — CID 82447089
2-butyl-6-(3,4-dimethylphenyl)-3-oxopyridazine-4-carbaldehyde (PubChem CID 82447089) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-butyl-6-(3,4-dimethylphenyl)-3-oxopyridazine-4-carbaldehyde.
| Compound Name | 2-butyl-6-(3,4-dimethylphenyl)-3-oxopyridazine-4-carbaldehyde |
|---|---|
| PubChem CID | 82447089 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-butyl-6-(3,4-dimethylphenyl)-3-oxopyridazine-4-carbaldehyde |
| SMILES | CCCCn1nc(-c2ccc(C)c(C)c2)cc(C=O)c1=O |
| InChI | InChI=1S/C17H20N2O2/c1-4-5-8-19-17(21)15(11-20)10-16(18-19)14-7-6-12(2)13(3)9-14/h6-7,9-11H,4-5,8H2,1-3H3 |
| InChIKey | KUWKOPZEIPBOFO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|