C18H23NO2 — CID 82448026
3-(2-tert-butyl-8-ethylquinolin-4-yl)propanoic acid (PubChem CID 82448026) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(2-tert-butyl-8-ethylquinolin-4-yl)propanoic acid.
| Compound Name | 3-(2-tert-butyl-8-ethylquinolin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 82448026 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-(2-tert-butyl-8-ethylquinolin-4-yl)propanoic acid |
| SMILES | CCc1cccc2c(CCC(=O)O)cc(C(C)(C)C)nc12 |
| InChI | InChI=1S/C18H23NO2/c1-5-12-7-6-8-14-13(9-10-16(20)21)11-15(18(2,3)4)19-17(12)14/h6-8,11H,5,9-10H2,1-4H3,(H,20,21) |
| InChIKey | CUSKGIXECMCBDG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |