C19H26N2 — CID 82448040
N-[(2-methyl-8-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine (PubChem CID 82448040) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[(2-methyl-8-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine.
| Compound Name | N-[(2-methyl-8-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 82448040 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-[(2-methyl-8-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine |
| SMILES | Cc1cc(CNC2CCCC2)c2cccc(C(C)C)c2n1 |
| InChI | InChI=1S/C19H26N2/c1-13(2)17-9-6-10-18-15(11-14(3)21-19(17)18)12-20-16-7-4-5-8-16/h6,9-11,13,16,20H,4-5,7-8,12H2,1-3H3 |
| InChIKey | ZZOXIMMBFDOWIX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |