About N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine
N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine (PubChem CID 82448549) has the molecular formula C20H28N2
and a molecular weight of 296.46 g/mol. Its IUPAC name is N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine.
Molecular Properties
| Compound Name | N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine |
| PubChem CID | 82448549 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine |
| SMILES | Cc1cc(C)c2nc(C(C)C)cc(CNC3CCCC3)c2c1 |
| InChI | InChI=1S/C20H28N2/c1-13(2)19-11-16(12-21-17-7-5-6-8-17)18-10-14(3)9-15(4)20(18)22-19/h9-11,13,17,21H,5-8,12H2,1-4H3 |
| InChIKey | SHOMEYZPOHBYSG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine?
The IUPAC name of N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine (CID 82448549) is N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine.
What is the SMILES notation for N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine?
The canonical SMILES for N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine is Cc1cc(C)c2nc(C(C)C)cc(CNC3CCCC3)c2c1.
What is the InChIKey of N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine?
The InChIKey is SHOMEYZPOHBYSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2/c1-13(2)19-11-16(12-21-17-7-5-6-8-17)18-10-14(3)9-15(4)20(18)22-19/h9-11,13,17,21H,5-8,12H2,1-4H3.
What are the key properties of N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine?
N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine has a molecular weight of 296.46 g/mol, XLogP of 5.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)methyl]cyclopentanamine is sourced from PubChem (CID 82448549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).