About 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline
4-(bromomethyl)-2,8-di(propan-2-yl)quinoline (PubChem CID 82448081) has the molecular formula C16H20BrN
and a molecular weight of 306.25 g/mol. Its IUPAC name is 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline.
Molecular Properties
| Compound Name | 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline |
| PubChem CID | 82448081 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline |
| SMILES | CC(C)c1cc(CBr)c2cccc(C(C)C)c2n1 |
| InChI | InChI=1S/C16H20BrN/c1-10(2)13-6-5-7-14-12(9-17)8-15(11(3)4)18-16(13)14/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | YWLIMCWBBQPCGD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline?
The IUPAC name of 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline (CID 82448081) is 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline.
What is the SMILES notation for 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline?
The canonical SMILES for 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline is CC(C)c1cc(CBr)c2cccc(C(C)C)c2n1.
What is the InChIKey of 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline?
The InChIKey is YWLIMCWBBQPCGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20BrN/c1-10(2)13-6-5-7-14-12(9-17)8-15(11(3)4)18-16(13)14/h5-8,10-11H,9H2,1-4H3.
What are the key properties of 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline?
4-(bromomethyl)-2,8-di(propan-2-yl)quinoline has a molecular weight of 306.25 g/mol, XLogP of 5.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-2,8-di(propan-2-yl)quinoline is sourced from PubChem (CID 82448081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).