C16H18N4S — CID 82448281
5-(6-ethyl-2-propan-2-ylquinolin-4-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82448281) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is 5-(6-ethyl-2-propan-2-ylquinolin-4-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(6-ethyl-2-propan-2-ylquinolin-4-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82448281 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-(6-ethyl-2-propan-2-ylquinolin-4-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCc1ccc2nc(C(C)C)cc(-c3nc(=S)[nH][nH]3)c2c1 |
| InChI | InChI=1S/C16H18N4S/c1-4-10-5-6-13-11(7-10)12(8-14(17-13)9(2)3)15-18-16(21)20-19-15/h5-9H,4H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | PDSHDIUQZBJQHR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|