C18H21NO2 — CID 82448792
(E)-3-(2-tert-butyl-6,7-dimethylquinolin-4-yl)prop-2-enoic acid (PubChem CID 82448792) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (E)-3-(2-tert-butyl-6,7-dimethylquinolin-4-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-tert-butyl-6,7-dimethylquinolin-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82448792 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (E)-3-(2-tert-butyl-6,7-dimethylquinolin-4-yl)prop-2-enoic acid |
| SMILES | Cc1cc2nc(C(C)(C)C)cc(/C=C/C(=O)O)c2cc1C |
| InChI | InChI=1S/C18H21NO2/c1-11-8-14-13(6-7-17(20)21)10-16(18(3,4)5)19-15(14)9-12(11)2/h6-10H,1-5H3,(H,20,21)/b7-6+ |
| InChIKey | ATGSZPSVABJVBK-VOTSOKGWSA-N |
| XLogP | 4.25 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|