C17H17FN2O2 — CID 82451534
(E)-3-(2-ethyl-8-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)prop-2-enoic acid (PubChem CID 82451534) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is (E)-3-(2-ethyl-8-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-ethyl-8-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82451534 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (E)-3-(2-ethyl-8-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)prop-2-enoic acid |
| SMILES | CCN1CCc2nc3ccc(F)cc3c(/C=C/C(=O)O)c2C1 |
| InChI | InChI=1S/C17H17FN2O2/c1-2-20-8-7-16-14(10-20)12(4-6-17(21)22)13-9-11(18)3-5-15(13)19-16/h3-6,9H,2,7-8,10H2,1H3,(H,21,22)/b6-4+ |
| InChIKey | PXNCOCSXJFWCKW-GQCTYLIASA-N |
| XLogP | 2.85 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|