C15H20N4S — CID 82452245
4-butyl-3-(2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 82452245) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-butyl-3-(2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-butyl-3-(2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82452245 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-butyl-3-(2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCn1c(-c2cc3c(nc2C)CCC3)n[nH]c1=S |
| InChI | InChI=1S/C15H20N4S/c1-3-4-8-19-14(17-18-15(19)20)12-9-11-6-5-7-13(11)16-10(12)2/h9H,3-8H2,1-2H3,(H,18,20) |
| InChIKey | ANUGWRAFWYINDS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|