C15H14N4OS — CID 82453123
5-[6-(4-methoxyphenyl)-2-methyl-3-pyridinyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82453123) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-[6-(4-methoxyphenyl)-2-methyl-3-pyridinyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[6-(4-methoxyphenyl)-2-methyl-3-pyridinyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82453123 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-[6-(4-methoxyphenyl)-2-methyl-3-pyridinyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-c2ccc(-c3nc(=S)[nH][nH]3)c(C)n2)cc1 |
| InChI | InChI=1S/C15H14N4OS/c1-9-12(14-17-15(21)19-18-14)7-8-13(16-9)10-3-5-11(20-2)6-4-10/h3-8H,1-2H3,(H2,17,18,19,21) |
| InChIKey | ZUFSBJAOWFAFJW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|