C17H30N4O — CID 82455919
4-N-cycloheptyl-2-propan-2-yl-6-propoxypyrimidine-4,5-diamine (PubChem CID 82455919) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-N-cycloheptyl-2-propan-2-yl-6-propoxypyrimidine-4,5-diamine.
| Compound Name | 4-N-cycloheptyl-2-propan-2-yl-6-propoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455919 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 4-N-cycloheptyl-2-propan-2-yl-6-propoxypyrimidine-4,5-diamine |
| SMILES | CCCOc1nc(C(C)C)nc(NC2CCCCCC2)c1N |
| InChI | InChI=1S/C17H30N4O/c1-4-11-22-17-14(18)16(20-15(21-17)12(2)3)19-13-9-7-5-6-8-10-13/h12-13H,4-11,18H2,1-3H3,(H,19,20,21) |
| InChIKey | HJLSGPUKTYKDOJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |