C13H23N3S — CID 82457157
2-methyl-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione (PubChem CID 82457157) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-methyl-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-methyl-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457157 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-methyl-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)cc(NC(C)(C)CC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C13H23N3S/c1-9-14-10(7-11(17)15-9)16-13(5,6)8-12(2,3)4/h7H,8H2,1-6H3,(H2,14,15,16,17) |
| InChIKey | YISOOGQKJDUHIO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|