C15H27N3S — CID 82457280
2-propan-2-yl-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione (PubChem CID 82457280) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 2-propan-2-yl-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-propan-2-yl-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457280 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-propan-2-yl-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1nc(=S)cc(NC(C)(C)CC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C15H27N3S/c1-10(2)13-16-11(8-12(19)17-13)18-15(6,7)9-14(3,4)5/h8,10H,9H2,1-7H3,(H2,16,17,18,19) |
| InChIKey | ORGFILFFLMEYCQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|