C13H22N4S — CID 82457161
2-methyl-6-(4-pyrrolidin-1-ylbutylamino)-1H-pyrimidine-4-thione (PubChem CID 82457161) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-methyl-6-(4-pyrrolidin-1-ylbutylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-methyl-6-(4-pyrrolidin-1-ylbutylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457161 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-methyl-6-(4-pyrrolidin-1-ylbutylamino)-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)cc(NCCCCN2CCCC2)[nH]1 |
| InChI | InChI=1S/C13H22N4S/c1-11-15-12(10-13(18)16-11)14-6-2-3-7-17-8-4-5-9-17/h10H,2-9H2,1H3,(H2,14,15,16,18) |
| InChIKey | MZFOZGKYOLJCMP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|