C13H24N4S — CID 82457160
6-[4-(diethylamino)butylamino]-2-methyl-1H-pyrimidine-4-thione (PubChem CID 82457160) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is 6-[4-(diethylamino)butylamino]-2-methyl-1H-pyrimidine-4-thione.
| Compound Name | 6-[4-(diethylamino)butylamino]-2-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457160 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 6-[4-(diethylamino)butylamino]-2-methyl-1H-pyrimidine-4-thione |
| SMILES | CCN(CC)CCCCNc1cc(=S)nc(C)[nH]1 |
| InChI | InChI=1S/C13H24N4S/c1-4-17(5-2)9-7-6-8-14-12-10-13(18)16-11(3)15-12/h10H,4-9H2,1-3H3,(H2,14,15,16,18) |
| InChIKey | FRYBMKBQPJDWSZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|