C12H23N3S — CID 143033433
6-(dimethylamino)-2-methyl-1H-pyrimidine-4-thione;ethane;prop-1-ene (PubChem CID 143033433) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 6-(dimethylamino)-2-methyl-1H-pyrimidine-4-thione;ethane;prop-1-ene.
| Compound Name | 6-(dimethylamino)-2-methyl-1H-pyrimidine-4-thione;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143033433 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 6-(dimethylamino)-2-methyl-1H-pyrimidine-4-thione;ethane;prop-1-ene |
| SMILES | C=CC.CC.Cc1nc(=S)cc(N(C)C)[nH]1 |
| InChI | InChI=1S/C7H11N3S.C3H6.C2H6/c1-5-8-6(10(2)3)4-7(11)9-5;1-3-2;1-2/h4H,1-3H3,(H,8,9,11);3H,1H2,2H3;1-2H3 |
| InChIKey | SIPAUCGFZOGPMS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|