C8H11N3S — CID 82457159
2-methyl-6-(prop-2-enylamino)-1H-pyrimidine-4-thione (PubChem CID 82457159) has the molecular formula C8H11N3S and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-methyl-6-(prop-2-enylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-methyl-6-(prop-2-enylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457159 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-methyl-6-(prop-2-enylamino)-1H-pyrimidine-4-thione |
| SMILES | C=CCNc1cc(=S)nc(C)[nH]1 |
| InChI | InChI=1S/C8H11N3S/c1-3-4-9-7-5-8(12)11-6(2)10-7/h3,5H,1,4H2,2H3,(H2,9,10,11,12) |
| InChIKey | DLHATMAQNDZISG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|