C9H13N3S — CID 82457221
2-ethyl-6-(prop-2-enylamino)-1H-pyrimidine-4-thione (PubChem CID 82457221) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-ethyl-6-(prop-2-enylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-ethyl-6-(prop-2-enylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457221 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-ethyl-6-(prop-2-enylamino)-1H-pyrimidine-4-thione |
| SMILES | C=CCNc1cc(=S)nc(CC)[nH]1 |
| InChI | InChI=1S/C9H13N3S/c1-3-5-10-8-6-9(13)12-7(4-2)11-8/h3,6H,1,4-5H2,2H3,(H2,10,11,12,13) |
| InChIKey | ZUNXCQLDGHCIAL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|