C11H20N4S — CID 82457228
6-[3-(dimethylamino)propylamino]-2-ethyl-1H-pyrimidine-4-thione (PubChem CID 82457228) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propylamino]-2-ethyl-1H-pyrimidine-4-thione.
| Compound Name | 6-[3-(dimethylamino)propylamino]-2-ethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457228 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-[3-(dimethylamino)propylamino]-2-ethyl-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)cc(NCCCN(C)C)[nH]1 |
| InChI | InChI=1S/C11H20N4S/c1-4-9-13-10(8-11(16)14-9)12-6-5-7-15(2)3/h8H,4-7H2,1-3H3,(H2,12,13,14,16) |
| InChIKey | YPLFSUJATPUDHP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|