C11H15N3OS — CID 82457586
6-(cyclopropylamino)-2-(oxolan-2-yl)-1H-pyrimidine-4-thione (PubChem CID 82457586) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 6-(cyclopropylamino)-2-(oxolan-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(cyclopropylamino)-2-(oxolan-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457586 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 6-(cyclopropylamino)-2-(oxolan-2-yl)-1H-pyrimidine-4-thione |
| SMILES | S=c1cc(NC2CC2)[nH]c(C2CCCO2)n1 |
| InChI | InChI=1S/C11H15N3OS/c16-10-6-9(12-7-3-4-7)13-11(14-10)8-2-1-5-15-8/h6-8H,1-5H2,(H2,12,13,14,16) |
| InChIKey | IKFGUZPREUCLBJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|