C14H22N4O2S — CID 82457623
6-(2-morpholin-4-ylethylamino)-2-(oxolan-2-yl)-1H-pyrimidine-4-thione (PubChem CID 82457623) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 6-(2-morpholin-4-ylethylamino)-2-(oxolan-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(2-morpholin-4-ylethylamino)-2-(oxolan-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457623 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 6-(2-morpholin-4-ylethylamino)-2-(oxolan-2-yl)-1H-pyrimidine-4-thione |
| SMILES | S=c1cc(NCCN2CCOCC2)[nH]c(C2CCCO2)n1 |
| InChI | InChI=1S/C14H22N4O2S/c21-13-10-12(15-3-4-18-5-8-19-9-6-18)16-14(17-13)11-2-1-7-20-11/h10-11H,1-9H2,(H2,15,16,17,21) |
| InChIKey | JWWNSZJKUFRVKN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|