C14H13ClN6 — CID 82459684
4-chloro-6,7-dimethyl-N-(pyridin-3-ylmethyl)pteridin-2-amine (PubChem CID 82459684) has the molecular formula C14H13ClN6 and a molecular weight of 300.75 g/mol. Its IUPAC name is 4-chloro-6,7-dimethyl-N-(pyridin-3-ylmethyl)pteridin-2-amine.
| Compound Name | 4-chloro-6,7-dimethyl-N-(pyridin-3-ylmethyl)pteridin-2-amine |
|---|---|
| PubChem CID | 82459684 |
| Molecular Formula | C14H13ClN6 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-chloro-6,7-dimethyl-N-(pyridin-3-ylmethyl)pteridin-2-amine |
| SMILES | Cc1nc2nc(NCc3cccnc3)nc(Cl)c2nc1C |
| InChI | InChI=1S/C14H13ClN6/c1-8-9(2)19-13-11(18-8)12(15)20-14(21-13)17-7-10-4-3-5-16-6-10/h3-6H,7H2,1-2H3,(H,17,19,20,21) |
| InChIKey | HGRGXWQPSYMCCE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |