C11H20N4O2S — CID 82459937
5-amino-1-pentan-3-yl-N-prop-2-enylpyrazole-4-sulfonamide (PubChem CID 82459937) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-amino-1-pentan-3-yl-N-prop-2-enylpyrazole-4-sulfonamide.
| Compound Name | 5-amino-1-pentan-3-yl-N-prop-2-enylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 82459937 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-amino-1-pentan-3-yl-N-prop-2-enylpyrazole-4-sulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cnn(C(CC)CC)c1N |
| InChI | InChI=1S/C11H20N4O2S/c1-4-7-14-18(16,17)10-8-13-15(11(10)12)9(5-2)6-3/h4,8-9,14H,1,5-7,12H2,2-3H3 |
| InChIKey | JKGIJSLAHYVHCT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|