C8H9ClF3N3O — CID 82460872
3-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 82460872) has the molecular formula C8H9ClF3N3O and a molecular weight of 255.63 g/mol. Its IUPAC name is 3-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 82460872 |
| Molecular Formula | C8H9ClF3N3O |
| Molecular Weight | 255.63 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 3-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | OCCCNc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C8H9ClF3N3O/c9-7-14-5(8(10,11)12)4-6(15-7)13-2-1-3-16/h4,16H,1-3H2,(H,13,14,15) |
| InChIKey | DJXCJILCNQACNJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|