C19H32N2O — CID 82461834
N',N'-diethyl-N-(2,2,7,8-tetramethyl-3,4-dihydrochromen-4-yl)ethane-1,2-diamine (PubChem CID 82461834) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is N',N'-diethyl-N-(2,2,7,8-tetramethyl-3,4-dihydrochromen-4-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(2,2,7,8-tetramethyl-3,4-dihydrochromen-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82461834 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | N',N'-diethyl-N-(2,2,7,8-tetramethyl-3,4-dihydrochromen-4-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNC1CC(C)(C)Oc2c1ccc(C)c2C |
| InChI | InChI=1S/C19H32N2O/c1-7-21(8-2)12-11-20-17-13-19(5,6)22-18-15(4)14(3)9-10-16(17)18/h9-10,17,20H,7-8,11-13H2,1-6H3 |
| InChIKey | GZNSQSNBELEEPG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |