C15H25N5O2 — CID 82466335
1-(2-aminobutyl)-8-ethyl-7-methyl-3-propan-2-ylpurine-2,6-dione (PubChem CID 82466335) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-(2-aminobutyl)-8-ethyl-7-methyl-3-propan-2-ylpurine-2,6-dione.
| Compound Name | 1-(2-aminobutyl)-8-ethyl-7-methyl-3-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 82466335 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 1-(2-aminobutyl)-8-ethyl-7-methyl-3-propan-2-ylpurine-2,6-dione |
| SMILES | CCc1nc2c(c(=O)n(CC(N)CC)c(=O)n2C(C)C)n1C |
| InChI | InChI=1S/C15H25N5O2/c1-6-10(16)8-19-14(21)12-13(17-11(7-2)18(12)5)20(9(3)4)15(19)22/h9-10H,6-8,16H2,1-5H3 |
| InChIKey | SBGRUNUDMGNRAJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |