C11H18N2O — CID 82466696
3-amino-1-butyl-4,6-dimethylpyridin-2-one (PubChem CID 82466696) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-amino-1-butyl-4,6-dimethylpyridin-2-one.
| Compound Name | 3-amino-1-butyl-4,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 82466696 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-amino-1-butyl-4,6-dimethylpyridin-2-one |
| SMILES | CCCCn1c(C)cc(C)c(N)c1=O |
| InChI | InChI=1S/C11H18N2O/c1-4-5-6-13-9(3)7-8(2)10(12)11(13)14/h7H,4-6,12H2,1-3H3 |
| InChIKey | GCXPVFTVWTXKHC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |