C11H13N3O2 — CID 82472359
4-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethoxy]aniline (PubChem CID 82472359) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethoxy]aniline.
| Compound Name | 4-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 82472359 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethoxy]aniline |
| SMILES | Cc1nnc(CCOc2ccc(N)cc2)o1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-13-14-11(16-8)6-7-15-10-4-2-9(12)3-5-10/h2-5H,6-7,12H2,1H3 |
| InChIKey | GNWFNFWRNSLLCN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|