C19H20N2O2 — CID 14009974
4-[2-(5-ethyl-4-phenyl-1,3-oxazol-2-yl)ethoxy]aniline (PubChem CID 14009974) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[2-(5-ethyl-4-phenyl-1,3-oxazol-2-yl)ethoxy]aniline.
| Compound Name | 4-[2-(5-ethyl-4-phenyl-1,3-oxazol-2-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 14009974 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-[2-(5-ethyl-4-phenyl-1,3-oxazol-2-yl)ethoxy]aniline |
| SMILES | CCc1oc(CCOc2ccc(N)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N2O2/c1-2-17-19(14-6-4-3-5-7-14)21-18(23-17)12-13-22-16-10-8-15(20)9-11-16/h3-11H,2,12-13,20H2,1H3 |
| InChIKey | CPHOSHUTWIKFCT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|