C11H15NO2S — CID 82473465
2-(2-methoxyphenyl)-1,4-thiazinane 1-oxide (PubChem CID 82473465) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,4-thiazinane 1-oxide.
| Compound Name | 2-(2-methoxyphenyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 82473465 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,4-thiazinane 1-oxide |
| SMILES | COc1ccccc1C1CNCCS1=O |
| InChI | InChI=1S/C11H15NO2S/c1-14-10-5-3-2-4-9(10)11-8-12-6-7-15(11)13/h2-5,11-12H,6-8H2,1H3 |
| InChIKey | ODBHAJBUGQVGGJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |