C12H17NO2S — CID 82477178
2-(2-methoxy-5-methylphenyl)-1,4-thiazinane 1-oxide (PubChem CID 82477178) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(2-methoxy-5-methylphenyl)-1,4-thiazinane 1-oxide.
| Compound Name | 2-(2-methoxy-5-methylphenyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 82477178 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(2-methoxy-5-methylphenyl)-1,4-thiazinane 1-oxide |
| SMILES | COc1ccc(C)cc1C1CNCCS1=O |
| InChI | InChI=1S/C12H17NO2S/c1-9-3-4-11(15-2)10(7-9)12-8-13-5-6-16(12)14/h3-4,7,12-13H,5-6,8H2,1-2H3 |
| InChIKey | KSMAHLKFULOMEQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |