C13H19NO2S — CID 82481833
2-(3-ethyl-4-methoxyphenyl)-1,4-thiazinane 1-oxide (PubChem CID 82481833) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-(3-ethyl-4-methoxyphenyl)-1,4-thiazinane 1-oxide.
| Compound Name | 2-(3-ethyl-4-methoxyphenyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 82481833 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(3-ethyl-4-methoxyphenyl)-1,4-thiazinane 1-oxide |
| SMILES | CCc1cc(C2CNCCS2=O)ccc1OC |
| InChI | InChI=1S/C13H19NO2S/c1-3-10-8-11(4-5-12(10)16-2)13-9-14-6-7-17(13)15/h4-5,8,13-14H,3,6-7,9H2,1-2H3 |
| InChIKey | PHUPLPYYOVODCU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |