C13H18N4 — CID 82474591
4-[2-(4,5-dimethyl-1,2,4-triazol-3-yl)propyl]aniline (PubChem CID 82474591) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[2-(4,5-dimethyl-1,2,4-triazol-3-yl)propyl]aniline.
| Compound Name | 4-[2-(4,5-dimethyl-1,2,4-triazol-3-yl)propyl]aniline |
|---|---|
| PubChem CID | 82474591 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4-[2-(4,5-dimethyl-1,2,4-triazol-3-yl)propyl]aniline |
| SMILES | Cc1nnc(C(C)Cc2ccc(N)cc2)n1C |
| InChI | InChI=1S/C13H18N4/c1-9(13-16-15-10(2)17(13)3)8-11-4-6-12(14)7-5-11/h4-7,9H,8,14H2,1-3H3 |
| InChIKey | AASOPOHAIPUVGT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|